C28H29F3O9S — CID 69431140
[(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[[4-(trifluoromethyl)phenyl]methyl]phenoxy]thian-2-yl]methyl acetate (PubChem CID 69431140) has the molecular formula C28H29F3O9S and a molecular weight of 598.59 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[[4-(trifluoromethyl)phenyl]methyl]phenoxy]thian-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[[4-(trifluoromethyl)phenyl]methyl]phenoxy]thian-2-yl]methyl acetate |
|---|---|
| PubChem CID | 69431140 |
| Molecular Formula | C28H29F3O9S |
| Molecular Weight | 598.59 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[[4-(trifluoromethyl)phenyl]methyl]phenoxy]thian-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1S[C@H](Oc2ccccc2Cc2ccc(C(F)(F)F)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H29F3O9S/c1-15(32)36-14-23-24(37-16(2)33)25(38-17(3)34)26(39-18(4)35)27(41-23)40-22-8-6-5-7-20(22)13-19-9-11-21(12-10-19)28(29,30)31/h5-12,23-27H,13-14H2,1-4H3/t23-,24+,25-,26+,27-/m0/s1 |
| InChIKey | LIODRTVYJYTLHG-HYFAGJRRSA-N |
| XLogP | 4.47 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|