C31H28F3NO4S2 — CID 69431302
(2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-sulfonic acid (PubChem CID 69431302) has the molecular formula C31H28F3NO4S2 and a molecular weight of 599.70 g/mol. Its IUPAC name is (2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-sulfonic acid.
| Compound Name | (2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-sulfonic acid |
|---|---|
| PubChem CID | 69431302 |
| Molecular Formula | C31H28F3NO4S2 |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 599.14 |
| IUPAC Name | (2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-sulfonic acid |
| SMILES | O=S(=O)(O)N1C[C@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C31H28F3NO4S2/c32-28-18-30(34)29(33)16-22(28)20-39-21-26-17-27(19-35(26)41(36,37)38)40-31(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-16,18,26-27H,17,19-21H2,(H,36,37,38)/t26-,27+/m0/s1 |
| InChIKey | IQIYDYAWZSOAGX-RRPNLBNLSA-N |
| XLogP | 6.59 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|