C22H18F3N3O3 — CID 69431517
2-[(1S,3S)-3-[[4-(trifluoromethyl)-1H-indazol-5-yl]oxy]cyclohexyl]isoindole-1,3-dione (PubChem CID 69431517) has the molecular formula C22H18F3N3O3 and a molecular weight of 429.40 g/mol. Its IUPAC name is 2-[(1S,3S)-3-[[4-(trifluoromethyl)-1H-indazol-5-yl]oxy]cyclohexyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S,3S)-3-[[4-(trifluoromethyl)-1H-indazol-5-yl]oxy]cyclohexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 69431517 |
| Molecular Formula | C22H18F3N3O3 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 2-[(1S,3S)-3-[[4-(trifluoromethyl)-1H-indazol-5-yl]oxy]cyclohexyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@H]1CCC[C@H](Oc2ccc3[nH]ncc3c2C(F)(F)F)C1 |
| InChI | InChI=1S/C22H18F3N3O3/c23-22(24,25)19-16-11-26-27-17(16)8-9-18(19)31-13-5-3-4-12(10-13)28-20(29)14-6-1-2-7-15(14)21(28)30/h1-2,6-9,11-13H,3-5,10H2,(H,26,27)/t12-,13-/m0/s1 |
| InChIKey | AHYJQUULYZGWCF-STQMWFEESA-N |
| XLogP | 4.57 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|