About 4-(4,4-dimethyl-1,4-diazepan-4-ium-1-yl)-2-methylaniline chloride
4-(4,4-dimethyl-1,4-diazepan-4-ium-1-yl)-2-methylaniline chloride (PubChem CID 69431612) has the molecular formula C14H24ClN3
and a molecular weight of 269.82 g/mol. Its IUPAC name is 4-(4,4-dimethyl-1,4-diazepan-4-ium-1-yl)-2-methylaniline chloride.
Molecular Properties
| Compound Name | 4-(4,4-dimethyl-1,4-diazepan-4-ium-1-yl)-2-methylaniline chloride |
| PubChem CID | 69431612 |
| Molecular Formula | C14H24ClN3 |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 4-(4,4-dimethyl-1,4-diazepan-4-ium-1-yl)-2-methylaniline chloride |
| SMILES | Cc1cc(N2CCC[N+](C)(C)CC2)ccc1N.[Cl-] |
| InChI | InChI=1S/C14H24N3.ClH/c1-12-11-13(5-6-14(12)15)16-7-4-9-17(2,3)10-8-16;/h5-6,11H,4,7-10,15H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | KXGYJBFUTPGZIQ-UHFFFAOYSA-M |
| XLogP | -1.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,4-dimethyl-1,4-diazepan-4-ium-1-yl)-2-methylaniline chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethyl-1,4-diazepan-4-ium-1-yl)-2-methylaniline chloride?
The IUPAC name of 4-(4,4-dimethyl-1,4-diazepan-4-ium-1-yl)-2-methylaniline chloride (CID 69431612) is 4-(4,4-dimethyl-1,4-diazepan-4-ium-1-yl)-2-methylaniline chloride.
What is the SMILES notation for 4-(4,4-dimethyl-1,4-diazepan-4-ium-1-yl)-2-methylaniline chloride?
The canonical SMILES for 4-(4,4-dimethyl-1,4-diazepan-4-ium-1-yl)-2-methylaniline chloride is Cc1cc(N2CCC[N+](C)(C)CC2)ccc1N.[Cl-].
What is the InChIKey of 4-(4,4-dimethyl-1,4-diazepan-4-ium-1-yl)-2-methylaniline chloride?
The InChIKey is KXGYJBFUTPGZIQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H24N3.ClH/c1-12-11-13(5-6-14(12)15)16-7-4-9-17(2,3)10-8-16;/h5-6,11H,4,7-10,15H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 4-(4,4-dimethyl-1,4-diazepan-4-ium-1-yl)-2-methylaniline chloride?
4-(4,4-dimethyl-1,4-diazepan-4-ium-1-yl)-2-methylaniline chloride has a molecular weight of 269.82 g/mol, XLogP of -1.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethyl-1,4-diazepan-4-ium-1-yl)-2-methylaniline chloride is sourced from PubChem (CID 69431612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).