About N-[(1R,3S)-3-[(4-ethyl-1H-indazol-5-yl)oxy]cyclohexyl]propanamide
N-[(1R,3S)-3-[(4-ethyl-1H-indazol-5-yl)oxy]cyclohexyl]propanamide (PubChem CID 69431824) has the molecular formula C18H25N3O2
and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[(1R,3S)-3-[(4-ethyl-1H-indazol-5-yl)oxy]cyclohexyl]propanamide.
Molecular Properties
| Compound Name | N-[(1R,3S)-3-[(4-ethyl-1H-indazol-5-yl)oxy]cyclohexyl]propanamide |
| PubChem CID | 69431824 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N-[(1R,3S)-3-[(4-ethyl-1H-indazol-5-yl)oxy]cyclohexyl]propanamide |
| SMILES | CCC(=O)N[C@@H]1CCC[C@H](Oc2ccc3[nH]ncc3c2CC)C1 |
| InChI | InChI=1S/C18H25N3O2/c1-3-14-15-11-19-21-16(15)8-9-17(14)23-13-7-5-6-12(10-13)20-18(22)4-2/h8-9,11-13H,3-7,10H2,1-2H3,(H,19,21)(H,20,22)/t12-,13+/m1/s1 |
| InChIKey | WZZYQTJWFMZFQQ-OLZOCXBDSA-N |
| XLogP | 3.34 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R,3S)-3-[(4-ethyl-1H-indazol-5-yl)oxy]cyclohexyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,3S)-3-[(4-ethyl-1H-indazol-5-yl)oxy]cyclohexyl]propanamide?
The IUPAC name of N-[(1R,3S)-3-[(4-ethyl-1H-indazol-5-yl)oxy]cyclohexyl]propanamide (CID 69431824) is N-[(1R,3S)-3-[(4-ethyl-1H-indazol-5-yl)oxy]cyclohexyl]propanamide.
What is the SMILES notation for N-[(1R,3S)-3-[(4-ethyl-1H-indazol-5-yl)oxy]cyclohexyl]propanamide?
The canonical SMILES for N-[(1R,3S)-3-[(4-ethyl-1H-indazol-5-yl)oxy]cyclohexyl]propanamide is CCC(=O)N[C@@H]1CCC[C@H](Oc2ccc3[nH]ncc3c2CC)C1.
What is the InChIKey of N-[(1R,3S)-3-[(4-ethyl-1H-indazol-5-yl)oxy]cyclohexyl]propanamide?
The InChIKey is WZZYQTJWFMZFQQ-OLZOCXBDSA-N. The full InChI is InChI=1S/C18H25N3O2/c1-3-14-15-11-19-21-16(15)8-9-17(14)23-13-7-5-6-12(10-13)20-18(22)4-2/h8-9,11-13H,3-7,10H2,1-2H3,(H,19,21)(H,20,22)/t12-,13+/m1/s1.
What are the key properties of N-[(1R,3S)-3-[(4-ethyl-1H-indazol-5-yl)oxy]cyclohexyl]propanamide?
N-[(1R,3S)-3-[(4-ethyl-1H-indazol-5-yl)oxy]cyclohexyl]propanamide has a molecular weight of 315.42 g/mol, XLogP of 3.34, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,3S)-3-[(4-ethyl-1H-indazol-5-yl)oxy]cyclohexyl]propanamide is sourced from PubChem (CID 69431824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).