About ditert-butyl (2S)-2-[(2-amino-4-fluorobenzoyl)amino]butanedioate
ditert-butyl (2S)-2-[(2-amino-4-fluorobenzoyl)amino]butanedioate (PubChem CID 69432085) has the molecular formula C19H27FN2O5
and a molecular weight of 382.43 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[(2-amino-4-fluorobenzoyl)amino]butanedioate.
Molecular Properties
| Compound Name | ditert-butyl (2S)-2-[(2-amino-4-fluorobenzoyl)amino]butanedioate |
| PubChem CID | 69432085 |
| Molecular Formula | C19H27FN2O5 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | ditert-butyl (2S)-2-[(2-amino-4-fluorobenzoyl)amino]butanedioate |
| SMILES | CC(C)(C)OC(=O)C[C@H](NC(=O)c1ccc(F)cc1N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27FN2O5/c1-18(2,3)26-15(23)10-14(17(25)27-19(4,5)6)22-16(24)12-8-7-11(20)9-13(12)21/h7-9,14H,10,21H2,1-6H3,(H,22,24)/t14-/m0/s1 |
| InChIKey | ZAHGQZDMDOUKBC-AWEZNQCLSA-N |
| XLogP | 2.58 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl (2S)-2-[(2-amino-4-fluorobenzoyl)amino]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (2S)-2-[(2-amino-4-fluorobenzoyl)amino]butanedioate?
The IUPAC name of ditert-butyl (2S)-2-[(2-amino-4-fluorobenzoyl)amino]butanedioate (CID 69432085) is ditert-butyl (2S)-2-[(2-amino-4-fluorobenzoyl)amino]butanedioate.
What is the SMILES notation for ditert-butyl (2S)-2-[(2-amino-4-fluorobenzoyl)amino]butanedioate?
The canonical SMILES for ditert-butyl (2S)-2-[(2-amino-4-fluorobenzoyl)amino]butanedioate is CC(C)(C)OC(=O)C[C@H](NC(=O)c1ccc(F)cc1N)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl (2S)-2-[(2-amino-4-fluorobenzoyl)amino]butanedioate?
The InChIKey is ZAHGQZDMDOUKBC-AWEZNQCLSA-N. The full InChI is InChI=1S/C19H27FN2O5/c1-18(2,3)26-15(23)10-14(17(25)27-19(4,5)6)22-16(24)12-8-7-11(20)9-13(12)21/h7-9,14H,10,21H2,1-6H3,(H,22,24)/t14-/m0/s1.
What are the key properties of ditert-butyl (2S)-2-[(2-amino-4-fluorobenzoyl)amino]butanedioate?
ditert-butyl (2S)-2-[(2-amino-4-fluorobenzoyl)amino]butanedioate has a molecular weight of 382.43 g/mol, XLogP of 2.58, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (2S)-2-[(2-amino-4-fluorobenzoyl)amino]butanedioate is sourced from PubChem (CID 69432085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).