C28H23Br2NO3 — CID 69432182
5,7-dibromo-3-[2-[(1,4-dihydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)methyl]-1H-inden-1-yl]-1,3-dihydroindol-2-one (PubChem CID 69432182) has the molecular formula C28H23Br2NO3 and a molecular weight of 581.30 g/mol. Its IUPAC name is 5,7-dibromo-3-[2-[(1,4-dihydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)methyl]-1H-inden-1-yl]-1,3-dihydroindol-2-one.
| Compound Name | 5,7-dibromo-3-[2-[(1,4-dihydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)methyl]-1H-inden-1-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 69432182 |
| Molecular Formula | C28H23Br2NO3 |
| Molecular Weight | 581.30 g/mol |
| Exact Mass | 579.00 |
| IUPAC Name | 5,7-dibromo-3-[2-[(1,4-dihydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)methyl]-1H-inden-1-yl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2c(Br)cc(Br)cc2C1C1C(Cc2cc(O)c3c(c2O)CCCC3)=Cc2ccccc21 |
| InChI | InChI=1S/C28H23Br2NO3/c29-17-12-21-25(28(34)31-26(21)22(30)13-17)24-15(9-14-5-1-2-6-18(14)24)10-16-11-23(32)19-7-3-4-8-20(19)27(16)33/h1-2,5-6,9,11-13,24-25,32-33H,3-4,7-8,10H2,(H,31,34) |
| InChIKey | YHXCCJUAKHWYII-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.30 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|