C34H54N2O2 — CID 69432261
6,6-dimethyl-3-(2-methyloctan-2-yl)-9-[(4-pyrrolidin-1-ylpiperidin-1-yl)methyl]-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 69432261) has the molecular formula C34H54N2O2 and a molecular weight of 522.82 g/mol. Its IUPAC name is 6,6-dimethyl-3-(2-methyloctan-2-yl)-9-[(4-pyrrolidin-1-ylpiperidin-1-yl)methyl]-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | 6,6-dimethyl-3-(2-methyloctan-2-yl)-9-[(4-pyrrolidin-1-ylpiperidin-1-yl)methyl]-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 69432261 |
| Molecular Formula | C34H54N2O2 |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 522.42 |
| IUPAC Name | 6,6-dimethyl-3-(2-methyloctan-2-yl)-9-[(4-pyrrolidin-1-ylpiperidin-1-yl)methyl]-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)C1CC=C(CN3CCC(N4CCCC4)CC3)CC21 |
| InChI | InChI=1S/C34H54N2O2/c1-6-7-8-9-16-33(2,3)26-22-30(37)32-28-21-25(12-13-29(28)34(4,5)38-31(32)23-26)24-35-19-14-27(15-20-35)36-17-10-11-18-36/h12,22-23,27-29,37H,6-11,13-21,24H2,1-5H3 |
| InChIKey | NPBOMRXAQOXZHX-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|