C21H24N8O — CID 69432652
2-(furan-2-yl)-5-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 69432652) has the molecular formula C21H24N8O and a molecular weight of 404.48 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(furan-2-yl)-5-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 69432652 |
| Molecular Formula | C21H24N8O |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-(furan-2-yl)-5-[4-[(2-methylphenyl)methyl]-1,4-diazepan-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Cc1ccccc1CN1CCCN(c2nc(N)n3nc(-c4ccco4)nc3n2)CC1 |
| InChI | InChI=1S/C21H24N8O/c1-15-6-2-3-7-16(15)14-27-9-5-10-28(12-11-27)20-24-19(22)29-21(25-20)23-18(26-29)17-8-4-13-30-17/h2-4,6-8,13H,5,9-12,14H2,1H3,(H2,22,23,24,25,26) |
| InChIKey | WSFSUOIAAGVEAB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |