C12H18N2O3 — CID 69432855
(2S)-1-[(2S)-2-aminopropanoyl]-2,3,3a,4,5,6-hexahydroindole-2-carboxylic acid (PubChem CID 69432855) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-aminopropanoyl]-2,3,3a,4,5,6-hexahydroindole-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-aminopropanoyl]-2,3,3a,4,5,6-hexahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 69432855 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | (2S)-1-[(2S)-2-aminopropanoyl]-2,3,3a,4,5,6-hexahydroindole-2-carboxylic acid |
| SMILES | C[C@H](N)C(=O)N1C2=CCCCC2C[C@H]1C(=O)O |
| InChI | InChI=1S/C12H18N2O3/c1-7(13)11(15)14-9-5-3-2-4-8(9)6-10(14)12(16)17/h5,7-8,10H,2-4,6,13H2,1H3,(H,16,17)/t7-,8?,10-/m0/s1 |
| InChIKey | RUJKFHZXUNIVSV-OFQRNFBNSA-N |
| XLogP | 0.70 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |