C34H30F3NO5S — CID 69433230
2-[(2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carbonyl]oxyacetic acid (PubChem CID 69433230) has the molecular formula C34H30F3NO5S and a molecular weight of 621.68 g/mol. Its IUPAC name is 2-[(2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carbonyl]oxyacetic acid.
| Compound Name | 2-[(2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carbonyl]oxyacetic acid |
|---|---|
| PubChem CID | 69433230 |
| Molecular Formula | C34H30F3NO5S |
| Molecular Weight | 621.68 g/mol |
| Exact Mass | 621.18 |
| IUPAC Name | 2-[(2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carbonyl]oxyacetic acid |
| SMILES | O=C(O)COC(=O)N1C[C@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C34H30F3NO5S/c35-29-18-31(37)30(36)16-23(29)20-42-21-27-17-28(19-38(27)33(41)43-22-32(39)40)44-34(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-16,18,27-28H,17,19-22H2,(H,39,40)/t27-,28+/m0/s1 |
| InChIKey | UPMHQRIJQFEAJD-WUFINQPMSA-N |
| XLogP | 7.01 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.68 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|