C20H20F2N2 — CID 69433357
(10R,15S)-7-(2,3-difluorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene (PubChem CID 69433357) has the molecular formula C20H20F2N2 and a molecular weight of 326.39 g/mol. Its IUPAC name is (10R,15S)-7-(2,3-difluorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene.
| Compound Name | (10R,15S)-7-(2,3-difluorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene |
|---|---|
| PubChem CID | 69433357 |
| Molecular Formula | C20H20F2N2 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (10R,15S)-7-(2,3-difluorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene |
| SMILES | Fc1cccc(-c2cc3c4c(c2)[C@@H]2CNCC[C@@H]2N4CCC3)c1F |
| InChI | InChI=1S/C20H20F2N2/c21-17-5-1-4-14(19(17)22)13-9-12-3-2-8-24-18-6-7-23-11-16(18)15(10-13)20(12)24/h1,4-5,9-10,16,18,23H,2-3,6-8,11H2/t16-,18-/m0/s1 |
| InChIKey | RCEASDVFEMYZLG-WMZOPIPTSA-N |
| XLogP | 3.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |