C20H19F3N8O — CID 69433365
2-(furan-2-yl)-5-N-[[1-[(2,4,6-trifluorophenyl)methyl]pyrrolidin-2-yl]methyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine (PubChem CID 69433365) has the molecular formula C20H19F3N8O and a molecular weight of 444.42 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-N-[[1-[(2,4,6-trifluorophenyl)methyl]pyrrolidin-2-yl]methyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine.
| Compound Name | 2-(furan-2-yl)-5-N-[[1-[(2,4,6-trifluorophenyl)methyl]pyrrolidin-2-yl]methyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
|---|---|
| PubChem CID | 69433365 |
| Molecular Formula | C20H19F3N8O |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-(furan-2-yl)-5-N-[[1-[(2,4,6-trifluorophenyl)methyl]pyrrolidin-2-yl]methyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
| SMILES | Nc1nc(NCC2CCCN2Cc2c(F)cc(F)cc2F)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C20H19F3N8O/c21-11-7-14(22)13(15(23)8-11)10-30-5-1-3-12(30)9-25-19-27-18(24)31-20(28-19)26-17(29-31)16-4-2-6-32-16/h2,4,6-8,12H,1,3,5,9-10H2,(H3,24,25,26,27,28,29) |
| InChIKey | ZHCSPKNWHTYBEP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |