About N-amino-3-[(4-hydrazinyl-4-phenyliminobutan-2-yl)diazenyl]-N'-phenylbutanimidamide
N-amino-3-[(4-hydrazinyl-4-phenyliminobutan-2-yl)diazenyl]-N'-phenylbutanimidamide (PubChem CID 69433881) has the molecular formula C20H28N8
and a molecular weight of 380.50 g/mol. Its IUPAC name is N-amino-3-[(4-hydrazinyl-4-phenyliminobutan-2-yl)diazenyl]-N'-phenylbutanimidamide.
Molecular Properties
| Compound Name | N-amino-3-[(4-hydrazinyl-4-phenyliminobutan-2-yl)diazenyl]-N'-phenylbutanimidamide |
| PubChem CID | 69433881 |
| Molecular Formula | C20H28N8 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | N-amino-3-[(4-hydrazinyl-4-phenyliminobutan-2-yl)diazenyl]-N'-phenylbutanimidamide |
| SMILES | CC(C/C(=N/c1ccccc1)NN)/N=N/C(C)C/C(=N\c1ccccc1)NN |
| InChI | InChI=1S/C20H28N8/c1-15(13-19(25-21)23-17-9-5-3-6-10-17)27-28-16(2)14-20(26-22)24-18-11-7-4-8-12-18/h3-12,15-16H,13-14,21-22H2,1-2H3,(H,23,25)(H,24,26)/b28-27+ |
| InChIKey | ZCXJXOKPTJVVLT-BYYHNAKLSA-N |
| XLogP | 3.38 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-amino-3-[(4-hydrazinyl-4-phenyliminobutan-2-yl)diazenyl]-N'-phenylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-3-[(4-hydrazinyl-4-phenyliminobutan-2-yl)diazenyl]-N'-phenylbutanimidamide?
The IUPAC name of N-amino-3-[(4-hydrazinyl-4-phenyliminobutan-2-yl)diazenyl]-N'-phenylbutanimidamide (CID 69433881) is N-amino-3-[(4-hydrazinyl-4-phenyliminobutan-2-yl)diazenyl]-N'-phenylbutanimidamide.
What is the SMILES notation for N-amino-3-[(4-hydrazinyl-4-phenyliminobutan-2-yl)diazenyl]-N'-phenylbutanimidamide?
The canonical SMILES for N-amino-3-[(4-hydrazinyl-4-phenyliminobutan-2-yl)diazenyl]-N'-phenylbutanimidamide is CC(C/C(=N/c1ccccc1)NN)/N=N/C(C)C/C(=N\c1ccccc1)NN.
What is the InChIKey of N-amino-3-[(4-hydrazinyl-4-phenyliminobutan-2-yl)diazenyl]-N'-phenylbutanimidamide?
The InChIKey is ZCXJXOKPTJVVLT-BYYHNAKLSA-N. The full InChI is InChI=1S/C20H28N8/c1-15(13-19(25-21)23-17-9-5-3-6-10-17)27-28-16(2)14-20(26-22)24-18-11-7-4-8-12-18/h3-12,15-16H,13-14,21-22H2,1-2H3,(H,23,25)(H,24,26)/b28-27+.
What are the key properties of N-amino-3-[(4-hydrazinyl-4-phenyliminobutan-2-yl)diazenyl]-N'-phenylbutanimidamide?
N-amino-3-[(4-hydrazinyl-4-phenyliminobutan-2-yl)diazenyl]-N'-phenylbutanimidamide has a molecular weight of 380.50 g/mol, XLogP of 3.38, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-3-[(4-hydrazinyl-4-phenyliminobutan-2-yl)diazenyl]-N'-phenylbutanimidamide is sourced from PubChem (CID 69433881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).