About [6-(N-carbamoyl-2,6-difluoroanilino)-2-(4-fluorophenyl)-3-pyridinyl] N-(2-methoxyethyl)carbamate
[6-(N-carbamoyl-2,6-difluoroanilino)-2-(4-fluorophenyl)-3-pyridinyl] N-(2-methoxyethyl)carbamate (PubChem CID 69434327) has the molecular formula C22H19F3N4O4
and a molecular weight of 460.41 g/mol. Its IUPAC name is [6-(N-carbamoyl-2,6-difluoroanilino)-2-(4-fluorophenyl)-3-pyridinyl] N-(2-methoxyethyl)carbamate.
Molecular Properties
| Compound Name | [6-(N-carbamoyl-2,6-difluoroanilino)-2-(4-fluorophenyl)-3-pyridinyl] N-(2-methoxyethyl)carbamate |
| PubChem CID | 69434327 |
| Molecular Formula | C22H19F3N4O4 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | [6-(N-carbamoyl-2,6-difluoroanilino)-2-(4-fluorophenyl)-3-pyridinyl] N-(2-methoxyethyl)carbamate |
| SMILES | COCCNC(=O)Oc1ccc(N(C(N)=O)c2c(F)cccc2F)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H19F3N4O4/c1-32-12-11-27-22(31)33-17-9-10-18(28-19(17)13-5-7-14(23)8-6-13)29(21(26)30)20-15(24)3-2-4-16(20)25/h2-10H,11-12H2,1H3,(H2,26,30)(H,27,31) |
| InChIKey | RGHSPUMELLIDDW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [6-(N-carbamoyl-2,6-difluoroanilino)-2-(4-fluorophenyl)-3-pyridinyl] N-(2-methoxyethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(N-carbamoyl-2,6-difluoroanilino)-2-(4-fluorophenyl)-3-pyridinyl] N-(2-methoxyethyl)carbamate?
The IUPAC name of [6-(N-carbamoyl-2,6-difluoroanilino)-2-(4-fluorophenyl)-3-pyridinyl] N-(2-methoxyethyl)carbamate (CID 69434327) is [6-(N-carbamoyl-2,6-difluoroanilino)-2-(4-fluorophenyl)-3-pyridinyl] N-(2-methoxyethyl)carbamate.
What is the SMILES notation for [6-(N-carbamoyl-2,6-difluoroanilino)-2-(4-fluorophenyl)-3-pyridinyl] N-(2-methoxyethyl)carbamate?
The canonical SMILES for [6-(N-carbamoyl-2,6-difluoroanilino)-2-(4-fluorophenyl)-3-pyridinyl] N-(2-methoxyethyl)carbamate is COCCNC(=O)Oc1ccc(N(C(N)=O)c2c(F)cccc2F)nc1-c1ccc(F)cc1.
What is the InChIKey of [6-(N-carbamoyl-2,6-difluoroanilino)-2-(4-fluorophenyl)-3-pyridinyl] N-(2-methoxyethyl)carbamate?
The InChIKey is RGHSPUMELLIDDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F3N4O4/c1-32-12-11-27-22(31)33-17-9-10-18(28-19(17)13-5-7-14(23)8-6-13)29(21(26)30)20-15(24)3-2-4-16(20)25/h2-10H,11-12H2,1H3,(H2,26,30)(H,27,31).
What are the key properties of [6-(N-carbamoyl-2,6-difluoroanilino)-2-(4-fluorophenyl)-3-pyridinyl] N-(2-methoxyethyl)carbamate?
[6-(N-carbamoyl-2,6-difluoroanilino)-2-(4-fluorophenyl)-3-pyridinyl] N-(2-methoxyethyl)carbamate has a molecular weight of 460.41 g/mol, XLogP of 4.12, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(N-carbamoyl-2,6-difluoroanilino)-2-(4-fluorophenyl)-3-pyridinyl] N-(2-methoxyethyl)carbamate is sourced from PubChem (CID 69434327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).