C8H8NO4- — CID 6943452
2-[furan-2-carbonyl(methyl)amino]acetate (PubChem CID 6943452) has the molecular formula C8H8NO4- and a molecular weight of 182.16 g/mol. Its IUPAC name is 2-[furan-2-carbonyl(methyl)amino]acetate.
| Compound Name | 2-[furan-2-carbonyl(methyl)amino]acetate |
|---|---|
| PubChem CID | 6943452 |
| Molecular Formula | C8H8NO4- |
| Molecular Weight | 182.16 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 2-[furan-2-carbonyl(methyl)amino]acetate |
| SMILES | CN(CC(=O)[O-])C(=O)c1ccco1 |
| InChI | InChI=1S/C8H9NO4/c1-9(5-7(10)11)8(12)6-3-2-4-13-6/h2-4H,5H2,1H3,(H,10,11)/p-1 |
| InChIKey | XGUIRNHIRGCLJK-UHFFFAOYSA-M |
| XLogP | -0.90 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.16 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |