About tributyl-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]stannane
tributyl-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]stannane (PubChem CID 69434687) has the molecular formula C27H37NO2SSn
and a molecular weight of 558.38 g/mol. Its IUPAC name is tributyl-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]stannane.
Molecular Properties
| Compound Name | tributyl-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]stannane |
| PubChem CID | 69434687 |
| Molecular Formula | C27H37NO2SSn |
| Molecular Weight | 558.38 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | tributyl-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cnc(Oc2ccc(Oc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C15H10NO2S.3C4H9.Sn/c1-2-4-12(5-3-1)17-13-6-8-14(9-7-13)18-15-16-10-11-19-15;3*1-3-4-2;/h1-10H;3*1,3-4H2,2H3; |
| InChIKey | ORNSHLGNEORTLK-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 558.38 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tributyl-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]stannane?
The IUPAC name of tributyl-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]stannane (CID 69434687) is tributyl-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]stannane.
What is the SMILES notation for tributyl-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]stannane?
The canonical SMILES for tributyl-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]stannane is CCCC[Sn](CCCC)(CCCC)c1cnc(Oc2ccc(Oc3ccccc3)cc2)s1.
What is the InChIKey of tributyl-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]stannane?
The InChIKey is ORNSHLGNEORTLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10NO2S.3C4H9.Sn/c1-2-4-12(5-3-1)17-13-6-8-14(9-7-13)18-15-16-10-11-19-15;3*1-3-4-2;/h1-10H;3*1,3-4H2,2H3;.
What are the key properties of tributyl-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]stannane?
tributyl-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]stannane has a molecular weight of 558.38 g/mol, XLogP of 8.78, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[2-(4-phenoxyphenoxy)-1,3-thiazol-5-yl]stannane is sourced from PubChem (CID 69434687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).