C27H28N2O3S — CID 69434718
methyl 6-[3-(4-methylphenyl)-2-phenylsulfanylbenzimidazol-5-yl]oxyhexanoate (PubChem CID 69434718) has the molecular formula C27H28N2O3S and a molecular weight of 460.60 g/mol. Its IUPAC name is methyl 6-[3-(4-methylphenyl)-2-phenylsulfanylbenzimidazol-5-yl]oxyhexanoate.
| Compound Name | methyl 6-[3-(4-methylphenyl)-2-phenylsulfanylbenzimidazol-5-yl]oxyhexanoate |
|---|---|
| PubChem CID | 69434718 |
| Molecular Formula | C27H28N2O3S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | methyl 6-[3-(4-methylphenyl)-2-phenylsulfanylbenzimidazol-5-yl]oxyhexanoate |
| SMILES | COC(=O)CCCCCOc1ccc2nc(Sc3ccccc3)n(-c3ccc(C)cc3)c2c1 |
| InChI | InChI=1S/C27H28N2O3S/c1-20-12-14-21(15-13-20)29-25-19-22(32-18-8-4-7-11-26(30)31-2)16-17-24(25)28-27(29)33-23-9-5-3-6-10-23/h3,5-6,9-10,12-17,19H,4,7-8,11,18H2,1-2H3 |
| InChIKey | ONLSZUAIAVPFLP-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|