About (1,4-diethylpyrazol-5-yl)hydrazine;hydrobromide
(1,4-diethylpyrazol-5-yl)hydrazine;hydrobromide (PubChem CID 69434989) has the molecular formula C7H15BrN4
and a molecular weight of 235.13 g/mol. Its IUPAC name is (1,4-diethylpyrazol-5-yl)hydrazine;hydrobromide.
Molecular Properties
| Compound Name | (1,4-diethylpyrazol-5-yl)hydrazine;hydrobromide |
| PubChem CID | 69434989 |
| Molecular Formula | C7H15BrN4 |
| Molecular Weight | 235.13 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | (1,4-diethylpyrazol-5-yl)hydrazine;hydrobromide |
| SMILES | Br.CCc1cnn(CC)c1NN |
| InChI | InChI=1S/C7H14N4.BrH/c1-3-6-5-9-11(4-2)7(6)10-8;/h5,10H,3-4,8H2,1-2H3;1H |
| InChIKey | KXKKFXZMJQIJNW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.13 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1,4-diethylpyrazol-5-yl)hydrazine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-diethylpyrazol-5-yl)hydrazine;hydrobromide?
The IUPAC name of (1,4-diethylpyrazol-5-yl)hydrazine;hydrobromide (CID 69434989) is (1,4-diethylpyrazol-5-yl)hydrazine;hydrobromide.
What is the SMILES notation for (1,4-diethylpyrazol-5-yl)hydrazine;hydrobromide?
The canonical SMILES for (1,4-diethylpyrazol-5-yl)hydrazine;hydrobromide is Br.CCc1cnn(CC)c1NN.
What is the InChIKey of (1,4-diethylpyrazol-5-yl)hydrazine;hydrobromide?
The InChIKey is KXKKFXZMJQIJNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4.BrH/c1-3-6-5-9-11(4-2)7(6)10-8;/h5,10H,3-4,8H2,1-2H3;1H.
What are the key properties of (1,4-diethylpyrazol-5-yl)hydrazine;hydrobromide?
(1,4-diethylpyrazol-5-yl)hydrazine;hydrobromide has a molecular weight of 235.13 g/mol, XLogP of 1.33, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-diethylpyrazol-5-yl)hydrazine;hydrobromide is sourced from PubChem (CID 69434989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).