C23H24BrN3O6 — CID 69435121
tert-butyl (8R)-5-(2-bromo-3-methyl-4-nitrophenyl)-8-methyl-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carboxylate (PubChem CID 69435121) has the molecular formula C23H24BrN3O6 and a molecular weight of 518.36 g/mol. Its IUPAC name is tert-butyl (8R)-5-(2-bromo-3-methyl-4-nitrophenyl)-8-methyl-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carboxylate.
| Compound Name | tert-butyl (8R)-5-(2-bromo-3-methyl-4-nitrophenyl)-8-methyl-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carboxylate |
|---|---|
| PubChem CID | 69435121 |
| Molecular Formula | C23H24BrN3O6 |
| Molecular Weight | 518.36 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | tert-butyl (8R)-5-(2-bromo-3-methyl-4-nitrophenyl)-8-methyl-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carboxylate |
| SMILES | Cc1c([N+](=O)[O-])ccc(C2=NN(C(=O)OC(C)(C)C)[C@H](C)Cc3cc4c(cc32)OCO4)c1Br |
| InChI | InChI=1S/C23H24BrN3O6/c1-12-8-14-9-18-19(32-11-31-18)10-16(14)21(25-26(12)22(28)33-23(3,4)5)15-6-7-17(27(29)30)13(2)20(15)24/h6-7,9-10,12H,8,11H2,1-5H3/t12-/m1/s1 |
| InChIKey | YNBSLPIJTRHSIX-GFCCVEGCSA-N |
| XLogP | 5.33 |
| TPSA | 103.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.36 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|