C30H37ClN2O4 — CID 69435148
[(4bR,7S,8aS)-7-(2-chloroethynyl)-4b-[2-[4-[(dimethylamino)methyl]phenoxy]ethyl]-7-hydroxy-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] N,N-dimethylcarbamate (PubChem CID 69435148) has the molecular formula C30H37ClN2O4 and a molecular weight of 525.09 g/mol. Its IUPAC name is [(4bR,7S,8aS)-7-(2-chloroethynyl)-4b-[2-[4-[(dimethylamino)methyl]phenoxy]ethyl]-7-hydroxy-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(4bR,7S,8aS)-7-(2-chloroethynyl)-4b-[2-[4-[(dimethylamino)methyl]phenoxy]ethyl]-7-hydroxy-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 69435148 |
| Molecular Formula | C30H37ClN2O4 |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | [(4bR,7S,8aS)-7-(2-chloroethynyl)-4b-[2-[4-[(dimethylamino)methyl]phenoxy]ethyl]-7-hydroxy-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)Cc1ccc(OCC[C@]23CC[C@@](O)(C#CCl)C[C@@H]2CCc2cc(OC(=O)N(C)C)ccc23)cc1 |
| InChI | InChI=1S/C30H37ClN2O4/c1-32(2)21-22-5-9-25(10-6-22)36-18-16-30-14-13-29(35,15-17-31)20-24(30)8-7-23-19-26(11-12-27(23)30)37-28(34)33(3)4/h5-6,9-12,19,24,35H,7-8,13-14,16,18,20-21H2,1-4H3/t24-,29+,30+/m0/s1 |
| InChIKey | NUQQLYWDJOFGKT-SICUDWHYSA-N |
| XLogP | 5.19 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|