About 1-[2-(3,4-diamino-5-methylpyrazol-1-yl)ethyl]pyrrolidin-3-ol
1-[2-(3,4-diamino-5-methylpyrazol-1-yl)ethyl]pyrrolidin-3-ol (PubChem CID 69435237) has the molecular formula C10H19N5O
and a molecular weight of 225.30 g/mol. Its IUPAC name is 1-[2-(3,4-diamino-5-methylpyrazol-1-yl)ethyl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-[2-(3,4-diamino-5-methylpyrazol-1-yl)ethyl]pyrrolidin-3-ol |
| PubChem CID | 69435237 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 1-[2-(3,4-diamino-5-methylpyrazol-1-yl)ethyl]pyrrolidin-3-ol |
| SMILES | Cc1c(N)c(N)nn1CCN1CCC(O)C1 |
| InChI | InChI=1S/C10H19N5O/c1-7-9(11)10(12)13-15(7)5-4-14-3-2-8(16)6-14/h8,16H,2-6,11H2,1H3,(H2,12,13) |
| InChIKey | OWCUKNSWLSYVFB-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-(3,4-diamino-5-methylpyrazol-1-yl)ethyl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,4-diamino-5-methylpyrazol-1-yl)ethyl]pyrrolidin-3-ol?
The IUPAC name of 1-[2-(3,4-diamino-5-methylpyrazol-1-yl)ethyl]pyrrolidin-3-ol (CID 69435237) is 1-[2-(3,4-diamino-5-methylpyrazol-1-yl)ethyl]pyrrolidin-3-ol.
What is the SMILES notation for 1-[2-(3,4-diamino-5-methylpyrazol-1-yl)ethyl]pyrrolidin-3-ol?
The canonical SMILES for 1-[2-(3,4-diamino-5-methylpyrazol-1-yl)ethyl]pyrrolidin-3-ol is Cc1c(N)c(N)nn1CCN1CCC(O)C1.
What is the InChIKey of 1-[2-(3,4-diamino-5-methylpyrazol-1-yl)ethyl]pyrrolidin-3-ol?
The InChIKey is OWCUKNSWLSYVFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5O/c1-7-9(11)10(12)13-15(7)5-4-14-3-2-8(16)6-14/h8,16H,2-6,11H2,1H3,(H2,12,13).
What are the key properties of 1-[2-(3,4-diamino-5-methylpyrazol-1-yl)ethyl]pyrrolidin-3-ol?
1-[2-(3,4-diamino-5-methylpyrazol-1-yl)ethyl]pyrrolidin-3-ol has a molecular weight of 225.30 g/mol, XLogP of -0.58, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,4-diamino-5-methylpyrazol-1-yl)ethyl]pyrrolidin-3-ol is sourced from PubChem (CID 69435237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).