C24H20N4O5S — CID 69435327
2-[1-[3-[2-(4-propan-2-yloxyphenoxy)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-5-yl]ethyl]isoindole-1,3-dione (PubChem CID 69435327) has the molecular formula C24H20N4O5S and a molecular weight of 476.51 g/mol. Its IUPAC name is 2-[1-[3-[2-(4-propan-2-yloxyphenoxy)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-5-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[3-[2-(4-propan-2-yloxyphenoxy)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-5-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 69435327 |
| Molecular Formula | C24H20N4O5S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 2-[1-[3-[2-(4-propan-2-yloxyphenoxy)-1,3-thiazol-5-yl]-1,2,4-oxadiazol-5-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC(C)Oc1ccc(Oc2ncc(-c3noc(C(C)N4C(=O)c5ccccc5C4=O)n3)s2)cc1 |
| InChI | InChI=1S/C24H20N4O5S/c1-13(2)31-15-8-10-16(11-9-15)32-24-25-12-19(34-24)20-26-21(33-27-20)14(3)28-22(29)17-6-4-5-7-18(17)23(28)30/h4-14H,1-3H3 |
| InChIKey | ZDVHOQOITHGATH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 107.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|