About ethyl 1H-indole-2-carboxylate;4-[(3-phenylindol-1-yl)methyl]aniline
ethyl 1H-indole-2-carboxylate;4-[(3-phenylindol-1-yl)methyl]aniline (PubChem CID 69435471) has the molecular formula C32H29N3O2
and a molecular weight of 487.60 g/mol. Its IUPAC name is ethyl 1H-indole-2-carboxylate;4-[(3-phenylindol-1-yl)methyl]aniline.
Molecular Properties
| Compound Name | ethyl 1H-indole-2-carboxylate;4-[(3-phenylindol-1-yl)methyl]aniline |
| PubChem CID | 69435471 |
| Molecular Formula | C32H29N3O2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | ethyl 1H-indole-2-carboxylate;4-[(3-phenylindol-1-yl)methyl]aniline |
| SMILES | CCOC(=O)c1cc2ccccc2[nH]1.Nc1ccc(Cn2cc(-c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C21H18N2.C11H11NO2/c22-18-12-10-16(11-13-18)14-23-15-20(17-6-2-1-3-7-17)19-8-4-5-9-21(19)23;1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10/h1-13,15H,14,22H2;3-7,12H,2H2,1H3 |
| InChIKey | XOCYFLCLKOICEO-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1H-indole-2-carboxylate;4-[(3-phenylindol-1-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1H-indole-2-carboxylate;4-[(3-phenylindol-1-yl)methyl]aniline?
The IUPAC name of ethyl 1H-indole-2-carboxylate;4-[(3-phenylindol-1-yl)methyl]aniline (CID 69435471) is ethyl 1H-indole-2-carboxylate;4-[(3-phenylindol-1-yl)methyl]aniline.
What is the SMILES notation for ethyl 1H-indole-2-carboxylate;4-[(3-phenylindol-1-yl)methyl]aniline?
The canonical SMILES for ethyl 1H-indole-2-carboxylate;4-[(3-phenylindol-1-yl)methyl]aniline is CCOC(=O)c1cc2ccccc2[nH]1.Nc1ccc(Cn2cc(-c3ccccc3)c3ccccc32)cc1.
What is the InChIKey of ethyl 1H-indole-2-carboxylate;4-[(3-phenylindol-1-yl)methyl]aniline?
The InChIKey is XOCYFLCLKOICEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2.C11H11NO2/c22-18-12-10-16(11-13-18)14-23-15-20(17-6-2-1-3-7-17)19-8-4-5-9-21(19)23;1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10/h1-13,15H,14,22H2;3-7,12H,2H2,1H3.
What are the key properties of ethyl 1H-indole-2-carboxylate;4-[(3-phenylindol-1-yl)methyl]aniline?
ethyl 1H-indole-2-carboxylate;4-[(3-phenylindol-1-yl)methyl]aniline has a molecular weight of 487.60 g/mol, XLogP of 7.28, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1H-indole-2-carboxylate;4-[(3-phenylindol-1-yl)methyl]aniline is sourced from PubChem (CID 69435471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).