C25H21N3O5S — CID 69435608
2-[(1R)-1-[3-[2-(4-propan-2-yloxyphenoxy)-1,3-thiazol-5-yl]-1,2-oxazol-5-yl]ethyl]isoindole-1,3-dione (PubChem CID 69435608) has the molecular formula C25H21N3O5S and a molecular weight of 475.53 g/mol. Its IUPAC name is 2-[(1R)-1-[3-[2-(4-propan-2-yloxyphenoxy)-1,3-thiazol-5-yl]-1,2-oxazol-5-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[(1R)-1-[3-[2-(4-propan-2-yloxyphenoxy)-1,3-thiazol-5-yl]-1,2-oxazol-5-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 69435608 |
| Molecular Formula | C25H21N3O5S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2-[(1R)-1-[3-[2-(4-propan-2-yloxyphenoxy)-1,3-thiazol-5-yl]-1,2-oxazol-5-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC(C)Oc1ccc(Oc2ncc(-c3cc([C@@H](C)N4C(=O)c5ccccc5C4=O)on3)s2)cc1 |
| InChI | InChI=1S/C25H21N3O5S/c1-14(2)31-16-8-10-17(11-9-16)32-25-26-13-22(34-25)20-12-21(33-27-20)15(3)28-23(29)18-6-4-5-7-19(18)24(28)30/h4-15H,1-3H3/t15-/m1/s1 |
| InChIKey | WEURTWBYESJKLE-OAHLLOKOSA-N |
| XLogP | 5.73 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|