C20H23N9O — CID 69436241
2-(furan-2-yl)-5-[4-[2-(4-methyl-2-pyridinyl)ethyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 69436241) has the molecular formula C20H23N9O and a molecular weight of 405.47 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[4-[2-(4-methyl-2-pyridinyl)ethyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(furan-2-yl)-5-[4-[2-(4-methyl-2-pyridinyl)ethyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 69436241 |
| Molecular Formula | C20H23N9O |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 2-(furan-2-yl)-5-[4-[2-(4-methyl-2-pyridinyl)ethyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Cc1ccnc(CCN2CCN(c3nc(N)n4nc(-c5ccco5)nc4n3)CC2)c1 |
| InChI | InChI=1S/C20H23N9O/c1-14-4-6-22-15(13-14)5-7-27-8-10-28(11-9-27)19-24-18(21)29-20(25-19)23-17(26-29)16-3-2-12-30-16/h2-4,6,12-13H,5,7-11H2,1H3,(H2,21,23,24,25,26) |
| InChIKey | LCCOYOFTSAYWPF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |