About azanium;1-methylpyrrolidine;acetate
azanium;1-methylpyrrolidine;acetate (PubChem CID 69436437) has the molecular formula C7H18N2O2
and a molecular weight of 162.23 g/mol. Its IUPAC name is azanium;1-methylpyrrolidine;acetate.
Molecular Properties
| Compound Name | azanium;1-methylpyrrolidine;acetate |
| PubChem CID | 69436437 |
| Molecular Formula | C7H18N2O2 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | azanium;1-methylpyrrolidine;acetate |
| SMILES | CC(=O)[O-].CN1CCCC1.[NH4+] |
| InChI | InChI=1S/C5H11N.C2H4O2.H3N/c1-6-4-2-3-5-6;1-2(3)4;/h2-5H2,1H3;1H3,(H,3,4);1H3 |
| InChIKey | JZTFUIXDQGXJFV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azanium;1-methylpyrrolidine;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;1-methylpyrrolidine;acetate?
The IUPAC name of azanium;1-methylpyrrolidine;acetate (CID 69436437) is azanium;1-methylpyrrolidine;acetate.
What is the SMILES notation for azanium;1-methylpyrrolidine;acetate?
The canonical SMILES for azanium;1-methylpyrrolidine;acetate is CC(=O)[O-].CN1CCCC1.[NH4+].
What is the InChIKey of azanium;1-methylpyrrolidine;acetate?
The InChIKey is JZTFUIXDQGXJFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.C2H4O2.H3N/c1-6-4-2-3-5-6;1-2(3)4;/h2-5H2,1H3;1H3,(H,3,4);1H3.
What are the key properties of azanium;1-methylpyrrolidine;acetate?
azanium;1-methylpyrrolidine;acetate has a molecular weight of 162.23 g/mol, XLogP of -0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;1-methylpyrrolidine;acetate is sourced from PubChem (CID 69436437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).