C21H25F3N8O — CID 69436720
5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-methyl-N-(4-methyl-2-pyridinyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 69436720) has the molecular formula C21H25F3N8O and a molecular weight of 462.48 g/mol. Its IUPAC name is 5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-methyl-N-(4-methyl-2-pyridinyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-methyl-N-(4-methyl-2-pyridinyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 69436720 |
| Molecular Formula | C21H25F3N8O |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-methyl-N-(4-methyl-2-pyridinyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | Cc1ccnc(Nc2nc(N3C[C@@H]4C[C@H]3CN4)nc3c(C)nn(CCOCC(F)(F)F)c23)c1 |
| InChI | InChI=1S/C21H25F3N8O/c1-12-3-4-25-16(7-12)27-19-18-17(13(2)30-32(18)5-6-33-11-21(22,23)24)28-20(29-19)31-10-14-8-15(31)9-26-14/h3-4,7,14-15,26H,5-6,8-11H2,1-2H3,(H,25,27,28,29)/t14-,15-/m0/s1 |
| InChIKey | IGOGYLQMZWWKFO-GJZGRUSLSA-N |
| XLogP | 2.71 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|