C22H24N2O4 — CID 69436723
(2R,7S)-13-(3,4-dimethoxyphenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-triene-4-carboxylic acid (PubChem CID 69436723) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is (2R,7S)-13-(3,4-dimethoxyphenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-triene-4-carboxylic acid.
| Compound Name | (2R,7S)-13-(3,4-dimethoxyphenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 69436723 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (2R,7S)-13-(3,4-dimethoxyphenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-triene-4-carboxylic acid |
| SMILES | COc1ccc(-c2cc3c4c(c2)[C@@H]2CN(C(=O)O)CC[C@@H]2N4CC3)cc1OC |
| InChI | InChI=1S/C22H24N2O4/c1-27-19-4-3-13(11-20(19)28-2)15-9-14-5-8-24-18-6-7-23(22(25)26)12-17(18)16(10-15)21(14)24/h3-4,9-11,17-18H,5-8,12H2,1-2H3,(H,25,26)/t17-,18-/m0/s1 |
| InChIKey | DFCLGMRJONJZCX-ROUUACIJSA-N |
| XLogP | 3.58 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |