About 3-(3-hydroxypropyl)-N,N-bis(2-trimethylsilylethoxymethyl)benzenesulfonamide
3-(3-hydroxypropyl)-N,N-bis(2-trimethylsilylethoxymethyl)benzenesulfonamide (PubChem CID 69437781) has the molecular formula C21H41NO5SSi2
and a molecular weight of 475.80 g/mol. Its IUPAC name is 3-(3-hydroxypropyl)-N,N-bis(2-trimethylsilylethoxymethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-(3-hydroxypropyl)-N,N-bis(2-trimethylsilylethoxymethyl)benzenesulfonamide |
| PubChem CID | 69437781 |
| Molecular Formula | C21H41NO5SSi2 |
| Molecular Weight | 475.80 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 3-(3-hydroxypropyl)-N,N-bis(2-trimethylsilylethoxymethyl)benzenesulfonamide |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)S(=O)(=O)c1cccc(CCCO)c1 |
| InChI | InChI=1S/C21H41NO5SSi2/c1-29(2,3)15-13-26-18-22(19-27-14-16-30(4,5)6)28(24,25)21-11-7-9-20(17-21)10-8-12-23/h7,9,11,17,23H,8,10,12-16,18-19H2,1-6H3 |
| InChIKey | OKSGWOCXEMTNNT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.80 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-hydroxypropyl)-N,N-bis(2-trimethylsilylethoxymethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-hydroxypropyl)-N,N-bis(2-trimethylsilylethoxymethyl)benzenesulfonamide?
The IUPAC name of 3-(3-hydroxypropyl)-N,N-bis(2-trimethylsilylethoxymethyl)benzenesulfonamide (CID 69437781) is 3-(3-hydroxypropyl)-N,N-bis(2-trimethylsilylethoxymethyl)benzenesulfonamide.
What is the SMILES notation for 3-(3-hydroxypropyl)-N,N-bis(2-trimethylsilylethoxymethyl)benzenesulfonamide?
The canonical SMILES for 3-(3-hydroxypropyl)-N,N-bis(2-trimethylsilylethoxymethyl)benzenesulfonamide is C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)S(=O)(=O)c1cccc(CCCO)c1.
What is the InChIKey of 3-(3-hydroxypropyl)-N,N-bis(2-trimethylsilylethoxymethyl)benzenesulfonamide?
The InChIKey is OKSGWOCXEMTNNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H41NO5SSi2/c1-29(2,3)15-13-26-18-22(19-27-14-16-30(4,5)6)28(24,25)21-11-7-9-20(17-21)10-8-12-23/h7,9,11,17,23H,8,10,12-16,18-19H2,1-6H3.
What are the key properties of 3-(3-hydroxypropyl)-N,N-bis(2-trimethylsilylethoxymethyl)benzenesulfonamide?
3-(3-hydroxypropyl)-N,N-bis(2-trimethylsilylethoxymethyl)benzenesulfonamide has a molecular weight of 475.80 g/mol, XLogP of 4.23, 15 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-hydroxypropyl)-N,N-bis(2-trimethylsilylethoxymethyl)benzenesulfonamide is sourced from PubChem (CID 69437781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).