C13H15NO4 — CID 69437846
(1S,2S,3R,4S)-3-(1-methyl-2,5-dioxopyrrolidin-3-yl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 69437846) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is (1S,2S,3R,4S)-3-(1-methyl-2,5-dioxopyrrolidin-3-yl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2S,3R,4S)-3-(1-methyl-2,5-dioxopyrrolidin-3-yl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 69437846 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (1S,2S,3R,4S)-3-(1-methyl-2,5-dioxopyrrolidin-3-yl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CN1C(=O)CC([C@@H]2[C@@H](C(=O)O)[C@@H]3C=C[C@@H]2C3)C1=O |
| InChI | InChI=1S/C13H15NO4/c1-14-9(15)5-8(12(14)16)10-6-2-3-7(4-6)11(10)13(17)18/h2-3,6-8,10-11H,4-5H2,1H3,(H,17,18)/t6-,7-,8?,10-,11+/m1/s1 |
| InChIKey | USXJEJZCCYZCFA-FHWRKJSSSA-N |
| XLogP | 0.51 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|