C12H15ClN2 — CID 69438321
9-chloro-6-methyl-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole (PubChem CID 69438321) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is 9-chloro-6-methyl-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole.
| Compound Name | 9-chloro-6-methyl-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 69438321 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 9-chloro-6-methyl-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc(Cl)c2c1NC1CCNCC21 |
| InChI | InChI=1S/C12H15ClN2/c1-7-2-3-9(13)11-8-6-14-5-4-10(8)15-12(7)11/h2-3,8,10,14-15H,4-6H2,1H3 |
| InChIKey | OCDRAPJUEKZTIQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |