About 1,1-dicyclopentyl-2-[(1S,5R)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]ethanol
1,1-dicyclopentyl-2-[(1S,5R)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]ethanol (PubChem CID 69438471) has the molecular formula C21H37NO
and a molecular weight of 319.53 g/mol. Its IUPAC name is 1,1-dicyclopentyl-2-[(1S,5R)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]ethanol.
Molecular Properties
| Compound Name | 1,1-dicyclopentyl-2-[(1S,5R)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]ethanol |
| PubChem CID | 69438471 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | 1,1-dicyclopentyl-2-[(1S,5R)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]ethanol |
| SMILES | CN1[C@@H]2CCC[C@H]1CC(CC(O)(C1CCCC1)C1CCCC1)C2 |
| InChI | InChI=1S/C21H37NO/c1-22-19-11-6-12-20(22)14-16(13-19)15-21(23,17-7-2-3-8-17)18-9-4-5-10-18/h16-20,23H,2-15H2,1H3/t16?,19-,20+ |
| InChIKey | FDYGJPNWDCDKGN-XGSMCBPESA-N |
| XLogP | 4.75 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1-dicyclopentyl-2-[(1S,5R)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dicyclopentyl-2-[(1S,5R)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]ethanol?
The IUPAC name of 1,1-dicyclopentyl-2-[(1S,5R)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]ethanol (CID 69438471) is 1,1-dicyclopentyl-2-[(1S,5R)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]ethanol.
What is the SMILES notation for 1,1-dicyclopentyl-2-[(1S,5R)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]ethanol?
The canonical SMILES for 1,1-dicyclopentyl-2-[(1S,5R)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]ethanol is CN1[C@@H]2CCC[C@H]1CC(CC(O)(C1CCCC1)C1CCCC1)C2.
What is the InChIKey of 1,1-dicyclopentyl-2-[(1S,5R)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]ethanol?
The InChIKey is FDYGJPNWDCDKGN-XGSMCBPESA-N. The full InChI is InChI=1S/C21H37NO/c1-22-19-11-6-12-20(22)14-16(13-19)15-21(23,17-7-2-3-8-17)18-9-4-5-10-18/h16-20,23H,2-15H2,1H3/t16?,19-,20+.
What are the key properties of 1,1-dicyclopentyl-2-[(1S,5R)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]ethanol?
1,1-dicyclopentyl-2-[(1S,5R)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]ethanol has a molecular weight of 319.53 g/mol, XLogP of 4.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dicyclopentyl-2-[(1S,5R)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]ethanol is sourced from PubChem (CID 69438471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).