C20H22Cl2N2O3 — CID 69438481
3-cyano-N-(3-methoxyphenyl)-4-(2-methylpropoxy)benzamide;dichloromethane (PubChem CID 69438481) has the molecular formula C20H22Cl2N2O3 and a molecular weight of 409.31 g/mol. Its IUPAC name is 3-cyano-N-(3-methoxyphenyl)-4-(2-methylpropoxy)benzamide;dichloromethane.
| Compound Name | 3-cyano-N-(3-methoxyphenyl)-4-(2-methylpropoxy)benzamide;dichloromethane |
|---|---|
| PubChem CID | 69438481 |
| Molecular Formula | C20H22Cl2N2O3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 3-cyano-N-(3-methoxyphenyl)-4-(2-methylpropoxy)benzamide;dichloromethane |
| SMILES | COc1cccc(NC(=O)c2ccc(OCC(C)C)c(C#N)c2)c1.ClCCl |
| InChI | InChI=1S/C19H20N2O3.CH2Cl2/c1-13(2)12-24-18-8-7-14(9-15(18)11-20)19(22)21-16-5-4-6-17(10-16)23-3;2-1-3/h4-10,13H,12H2,1-3H3,(H,21,22);1H2 |
| InChIKey | LREBCBSCRVOTIB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|