About 5-methyl-1-sulfanyl-1,2,4-triazol-3-amine
5-methyl-1-sulfanyl-1,2,4-triazol-3-amine (PubChem CID 69438734) has the molecular formula C3H6N4S
and a molecular weight of 130.18 g/mol. Its IUPAC name is 5-methyl-1-sulfanyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-methyl-1-sulfanyl-1,2,4-triazol-3-amine |
| PubChem CID | 69438734 |
| Molecular Formula | C3H6N4S |
| Molecular Weight | 130.18 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 5-methyl-1-sulfanyl-1,2,4-triazol-3-amine |
| SMILES | Cc1nc(N)nn1S |
| InChI | InChI=1S/C3H6N4S/c1-2-5-3(4)6-7(2)8/h8H,1H3,(H2,4,6) |
| InChIKey | ZIEDEQQENAHKNW-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.18 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1-sulfanyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-sulfanyl-1,2,4-triazol-3-amine?
The IUPAC name of 5-methyl-1-sulfanyl-1,2,4-triazol-3-amine (CID 69438734) is 5-methyl-1-sulfanyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-methyl-1-sulfanyl-1,2,4-triazol-3-amine?
The canonical SMILES for 5-methyl-1-sulfanyl-1,2,4-triazol-3-amine is Cc1nc(N)nn1S.
What is the InChIKey of 5-methyl-1-sulfanyl-1,2,4-triazol-3-amine?
The InChIKey is ZIEDEQQENAHKNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N4S/c1-2-5-3(4)6-7(2)8/h8H,1H3,(H2,4,6).
What are the key properties of 5-methyl-1-sulfanyl-1,2,4-triazol-3-amine?
5-methyl-1-sulfanyl-1,2,4-triazol-3-amine has a molecular weight of 130.18 g/mol, XLogP of -0.14, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-sulfanyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 69438734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).