C26H22ClN3O5S — CID 69439042
2-[1-[3-[2-[2-chloro-4-(2-methylpropoxy)phenoxy]-1,3-thiazol-5-yl]-1,2-oxazol-5-yl]ethyl]isoindole-1,3-dione (PubChem CID 69439042) has the molecular formula C26H22ClN3O5S and a molecular weight of 524.00 g/mol. Its IUPAC name is 2-[1-[3-[2-[2-chloro-4-(2-methylpropoxy)phenoxy]-1,3-thiazol-5-yl]-1,2-oxazol-5-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[3-[2-[2-chloro-4-(2-methylpropoxy)phenoxy]-1,3-thiazol-5-yl]-1,2-oxazol-5-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 69439042 |
| Molecular Formula | C26H22ClN3O5S |
| Molecular Weight | 524.00 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 2-[1-[3-[2-[2-chloro-4-(2-methylpropoxy)phenoxy]-1,3-thiazol-5-yl]-1,2-oxazol-5-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC(C)COc1ccc(Oc2ncc(-c3cc(C(C)N4C(=O)c5ccccc5C4=O)on3)s2)c(Cl)c1 |
| InChI | InChI=1S/C26H22ClN3O5S/c1-14(2)13-33-16-8-9-21(19(27)10-16)34-26-28-12-23(36-26)20-11-22(35-29-20)15(3)30-24(31)17-6-4-5-7-18(17)25(30)32/h4-12,14-15H,13H2,1-3H3 |
| InChIKey | BWROJPFENPDDEM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.00 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|