C23H25N7O3 — CID 69439058
(1S,4R,5S,7R)-N-[4-[cyano-(3-ethyl-1H-benzimidazol-2-ylidene)methyl]-5-methylpyrimidin-2-yl]-4-methyl-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide (PubChem CID 69439058) has the molecular formula C23H25N7O3 and a molecular weight of 447.50 g/mol. Its IUPAC name is (1S,4R,5S,7R)-N-[4-[cyano-(3-ethyl-1H-benzimidazol-2-ylidene)methyl]-5-methylpyrimidin-2-yl]-4-methyl-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide.
| Compound Name | (1S,4R,5S,7R)-N-[4-[cyano-(3-ethyl-1H-benzimidazol-2-ylidene)methyl]-5-methylpyrimidin-2-yl]-4-methyl-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide |
|---|---|
| PubChem CID | 69439058 |
| Molecular Formula | C23H25N7O3 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (1S,4R,5S,7R)-N-[4-[cyano-(3-ethyl-1H-benzimidazol-2-ylidene)methyl]-5-methylpyrimidin-2-yl]-4-methyl-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide |
| SMILES | CCN1C(=C(C#N)c2nc(NC(=O)[C@@H]3O[C@@H]4O[C@H]3CN[C@@H]4C)ncc2C)Nc2ccccc21 |
| InChI | InChI=1S/C23H25N7O3/c1-4-30-16-8-6-5-7-15(16)27-20(30)14(9-24)18-12(2)10-26-23(28-18)29-21(31)19-17-11-25-13(3)22(32-17)33-19/h5-8,10,13,17,19,22,25,27H,4,11H2,1-3H3,(H,26,28,29,31)/t13-,17+,19-,22+/m1/s1 |
| InChIKey | WVPJODSJYBUJBX-IZXOZKLFSA-N |
| XLogP | 1.97 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|