C26H20ClN3O5S — CID 69439396
N-[2-[(4-chlorophenyl)sulfonylamino]-2-oxo-1-phenylethyl]-4-(2-oxo-1-pyridinyl)benzamide (PubChem CID 69439396) has the molecular formula C26H20ClN3O5S and a molecular weight of 521.98 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)sulfonylamino]-2-oxo-1-phenylethyl]-4-(2-oxo-1-pyridinyl)benzamide.
| Compound Name | N-[2-[(4-chlorophenyl)sulfonylamino]-2-oxo-1-phenylethyl]-4-(2-oxo-1-pyridinyl)benzamide |
|---|---|
| PubChem CID | 69439396 |
| Molecular Formula | C26H20ClN3O5S |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | N-[2-[(4-chlorophenyl)sulfonylamino]-2-oxo-1-phenylethyl]-4-(2-oxo-1-pyridinyl)benzamide |
| SMILES | O=C(NC(C(=O)NS(=O)(=O)c1ccc(Cl)cc1)c1ccccc1)c1ccc(-n2ccccc2=O)cc1 |
| InChI | InChI=1S/C26H20ClN3O5S/c27-20-11-15-22(16-12-20)36(34,35)29-26(33)24(18-6-2-1-3-7-18)28-25(32)19-9-13-21(14-10-19)30-17-5-4-8-23(30)31/h1-17,24H,(H,28,32)(H,29,33) |
| InChIKey | VTWJHHSRSDTUNF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |