C24H23F3N2O2 — CID 69440372
N-(cyclohexylmethyl)-2-oxo-1-[3-(trifluoromethyl)phenyl]quinoline-3-carboxamide (PubChem CID 69440372) has the molecular formula C24H23F3N2O2 and a molecular weight of 428.45 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-oxo-1-[3-(trifluoromethyl)phenyl]quinoline-3-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-2-oxo-1-[3-(trifluoromethyl)phenyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 69440372 |
| Molecular Formula | C24H23F3N2O2 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-(cyclohexylmethyl)-2-oxo-1-[3-(trifluoromethyl)phenyl]quinoline-3-carboxamide |
| SMILES | O=C(NCC1CCCCC1)c1cc2ccccc2n(-c2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C24H23F3N2O2/c25-24(26,27)18-10-6-11-19(14-18)29-21-12-5-4-9-17(21)13-20(23(29)31)22(30)28-15-16-7-2-1-3-8-16/h4-6,9-14,16H,1-3,7-8,15H2,(H,28,30) |
| InChIKey | GQLGXLJFFKNRLD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |