C29H36F3N3O6 — CID 69440805
1-[2-[[2-(2-methylpropoxy)phenyl]methyl]-2,8-diazaspiro[4.5]decan-8-yl]-2-(2-nitrophenyl)ethanone;2,2,2-trifluoroacetic acid (PubChem CID 69440805) has the molecular formula C29H36F3N3O6 and a molecular weight of 579.62 g/mol. Its IUPAC name is 1-[2-[[2-(2-methylpropoxy)phenyl]methyl]-2,8-diazaspiro[4.5]decan-8-yl]-2-(2-nitrophenyl)ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[2-[[2-(2-methylpropoxy)phenyl]methyl]-2,8-diazaspiro[4.5]decan-8-yl]-2-(2-nitrophenyl)ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69440805 |
| Molecular Formula | C29H36F3N3O6 |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | 1-[2-[[2-(2-methylpropoxy)phenyl]methyl]-2,8-diazaspiro[4.5]decan-8-yl]-2-(2-nitrophenyl)ethanone;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)COc1ccccc1CN1CCC2(CCN(C(=O)Cc3ccccc3[N+](=O)[O-])CC2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H35N3O4.C2HF3O2/c1-21(2)19-34-25-10-6-4-8-23(25)18-28-14-11-27(20-28)12-15-29(16-13-27)26(31)17-22-7-3-5-9-24(22)30(32)33;3-2(4,5)1(6)7/h3-10,21H,11-20H2,1-2H3;(H,6,7) |
| InChIKey | QQOVARRQTPWWQF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|