C19H26N2O2+2 — CID 6944123
4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-2-methoxyphenol (PubChem CID 6944123) has the molecular formula C19H26N2O2+2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-2-methoxyphenol.
| Compound Name | 4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 6944123 |
| Molecular Formula | C19H26N2O2+2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-2-methoxyphenol |
| SMILES | COc1cc(C[NH+]2CC[NH+](Cc3ccccc3)CC2)ccc1O |
| InChI | InChI=1S/C19H24N2O2/c1-23-19-13-17(7-8-18(19)22)15-21-11-9-20(10-12-21)14-16-5-3-2-4-6-16/h2-8,13,22H,9-12,14-15H2,1H3/p+2 |
| InChIKey | QDMDFODXNCYAFD-UHFFFAOYSA-P |
| XLogP | -0.12 |
| TPSA | 38.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |