C36H38N2O5 — CID 69441599
ethyl 3-[[2-[2-(benzylcarbamoyl)phenyl]benzoyl]-[2-(4-ethoxyphenyl)ethyl]amino]propanoate (PubChem CID 69441599) has the molecular formula C36H38N2O5 and a molecular weight of 578.71 g/mol. Its IUPAC name is ethyl 3-[[2-[2-(benzylcarbamoyl)phenyl]benzoyl]-[2-(4-ethoxyphenyl)ethyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-[2-(benzylcarbamoyl)phenyl]benzoyl]-[2-(4-ethoxyphenyl)ethyl]amino]propanoate |
|---|---|
| PubChem CID | 69441599 |
| Molecular Formula | C36H38N2O5 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | ethyl 3-[[2-[2-(benzylcarbamoyl)phenyl]benzoyl]-[2-(4-ethoxyphenyl)ethyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(CCc1ccc(OCC)cc1)C(=O)c1ccccc1-c1ccccc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C36H38N2O5/c1-3-42-29-20-18-27(19-21-29)22-24-38(25-23-34(39)43-4-2)36(41)33-17-11-9-15-31(33)30-14-8-10-16-32(30)35(40)37-26-28-12-6-5-7-13-28/h5-21H,3-4,22-26H2,1-2H3,(H,37,40) |
| InChIKey | JRGHVPLCQJPYAW-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |