About methyl-tris[(3,5,5-trimethylcyclohex-2-en-1-yl)oxy]silane
methyl-tris[(3,5,5-trimethylcyclohex-2-en-1-yl)oxy]silane (PubChem CID 69441986) has the molecular formula C28H48O3Si
and a molecular weight of 460.78 g/mol. Its IUPAC name is methyl-tris[(3,5,5-trimethylcyclohex-2-en-1-yl)oxy]silane.
Molecular Properties
| Compound Name | methyl-tris[(3,5,5-trimethylcyclohex-2-en-1-yl)oxy]silane |
| PubChem CID | 69441986 |
| Molecular Formula | C28H48O3Si |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | methyl-tris[(3,5,5-trimethylcyclohex-2-en-1-yl)oxy]silane |
| SMILES | CC1=CC(O[Si](C)(OC2C=C(C)CC(C)(C)C2)OC2C=C(C)CC(C)(C)C2)CC(C)(C)C1 |
| InChI | InChI=1S/C28H48O3Si/c1-20-11-23(17-26(4,5)14-20)29-32(10,30-24-12-21(2)15-27(6,7)18-24)31-25-13-22(3)16-28(8,9)19-25/h11-13,23-25H,14-19H2,1-10H3 |
| InChIKey | OCFCEJXVLXJJSN-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl-tris[(3,5,5-trimethylcyclohex-2-en-1-yl)oxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-tris[(3,5,5-trimethylcyclohex-2-en-1-yl)oxy]silane?
The IUPAC name of methyl-tris[(3,5,5-trimethylcyclohex-2-en-1-yl)oxy]silane (CID 69441986) is methyl-tris[(3,5,5-trimethylcyclohex-2-en-1-yl)oxy]silane.
What is the SMILES notation for methyl-tris[(3,5,5-trimethylcyclohex-2-en-1-yl)oxy]silane?
The canonical SMILES for methyl-tris[(3,5,5-trimethylcyclohex-2-en-1-yl)oxy]silane is CC1=CC(O[Si](C)(OC2C=C(C)CC(C)(C)C2)OC2C=C(C)CC(C)(C)C2)CC(C)(C)C1.
What is the InChIKey of methyl-tris[(3,5,5-trimethylcyclohex-2-en-1-yl)oxy]silane?
The InChIKey is OCFCEJXVLXJJSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H48O3Si/c1-20-11-23(17-26(4,5)14-20)29-32(10,30-24-12-21(2)15-27(6,7)18-24)31-25-13-22(3)16-28(8,9)19-25/h11-13,23-25H,14-19H2,1-10H3.
What are the key properties of methyl-tris[(3,5,5-trimethylcyclohex-2-en-1-yl)oxy]silane?
methyl-tris[(3,5,5-trimethylcyclohex-2-en-1-yl)oxy]silane has a molecular weight of 460.78 g/mol, XLogP of 8.01, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-tris[(3,5,5-trimethylcyclohex-2-en-1-yl)oxy]silane is sourced from PubChem (CID 69441986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).