About (4S)-1,3,3-trimethyl-4-phenylpiperidin-1-ium-4-ol
(4S)-1,3,3-trimethyl-4-phenylpiperidin-1-ium-4-ol (PubChem CID 6944225) has the molecular formula C14H22NO+
and a molecular weight of 220.34 g/mol. Its IUPAC name is (4S)-1,3,3-trimethyl-4-phenylpiperidin-1-ium-4-ol.
Molecular Properties
| Compound Name | (4S)-1,3,3-trimethyl-4-phenylpiperidin-1-ium-4-ol |
| PubChem CID | 6944225 |
| Molecular Formula | C14H22NO+ |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | (4S)-1,3,3-trimethyl-4-phenylpiperidin-1-ium-4-ol |
| SMILES | C[NH+]1CC[C@](O)(c2ccccc2)C(C)(C)C1 |
| InChI | InChI=1S/C14H21NO/c1-13(2)11-15(3)10-9-14(13,16)12-7-5-4-6-8-12/h4-8,16H,9-11H2,1-3H3/p+1/t14-/m0/s1 |
| InChIKey | ULHMJMVAPSQRBO-AWEZNQCLSA-O |
| XLogP | 0.82 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-1,3,3-trimethyl-4-phenylpiperidin-1-ium-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1,3,3-trimethyl-4-phenylpiperidin-1-ium-4-ol?
The IUPAC name of (4S)-1,3,3-trimethyl-4-phenylpiperidin-1-ium-4-ol (CID 6944225) is (4S)-1,3,3-trimethyl-4-phenylpiperidin-1-ium-4-ol.
What is the SMILES notation for (4S)-1,3,3-trimethyl-4-phenylpiperidin-1-ium-4-ol?
The canonical SMILES for (4S)-1,3,3-trimethyl-4-phenylpiperidin-1-ium-4-ol is C[NH+]1CC[C@](O)(c2ccccc2)C(C)(C)C1.
What is the InChIKey of (4S)-1,3,3-trimethyl-4-phenylpiperidin-1-ium-4-ol?
The InChIKey is ULHMJMVAPSQRBO-AWEZNQCLSA-O. The full InChI is InChI=1S/C14H21NO/c1-13(2)11-15(3)10-9-14(13,16)12-7-5-4-6-8-12/h4-8,16H,9-11H2,1-3H3/p+1/t14-/m0/s1.
What are the key properties of (4S)-1,3,3-trimethyl-4-phenylpiperidin-1-ium-4-ol?
(4S)-1,3,3-trimethyl-4-phenylpiperidin-1-ium-4-ol has a molecular weight of 220.34 g/mol, XLogP of 0.82, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1,3,3-trimethyl-4-phenylpiperidin-1-ium-4-ol is sourced from PubChem (CID 6944225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).