About potassium;hydrogen carbonate;6-piperidin-3-ylsulfanylisoquinolin-1-amine
potassium;hydrogen carbonate;6-piperidin-3-ylsulfanylisoquinolin-1-amine (PubChem CID 69442681) has the molecular formula C15H18KN3O3S
and a molecular weight of 359.49 g/mol. Its IUPAC name is potassium;hydrogen carbonate;6-piperidin-3-ylsulfanylisoquinolin-1-amine.
Molecular Properties
| Compound Name | potassium;hydrogen carbonate;6-piperidin-3-ylsulfanylisoquinolin-1-amine |
| PubChem CID | 69442681 |
| Molecular Formula | C15H18KN3O3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | potassium;hydrogen carbonate;6-piperidin-3-ylsulfanylisoquinolin-1-amine |
| SMILES | Nc1nccc2cc(SC3CCCNC3)ccc12.O=C([O-])O.[K+] |
| InChI | InChI=1S/C14H17N3S.CH2O3.K/c15-14-13-4-3-11(8-10(13)5-7-17-14)18-12-2-1-6-16-9-12;2-1(3)4;/h3-5,7-8,12,16H,1-2,6,9H2,(H2,15,17);(H2,2,3,4);/q;;+1/p-1 |
| InChIKey | JYKFAFZFDOGNDR-UHFFFAOYSA-M |
| XLogP | -1.45 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze potassium;hydrogen carbonate;6-piperidin-3-ylsulfanylisoquinolin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydrogen carbonate;6-piperidin-3-ylsulfanylisoquinolin-1-amine?
The IUPAC name of potassium;hydrogen carbonate;6-piperidin-3-ylsulfanylisoquinolin-1-amine (CID 69442681) is potassium;hydrogen carbonate;6-piperidin-3-ylsulfanylisoquinolin-1-amine.
What is the SMILES notation for potassium;hydrogen carbonate;6-piperidin-3-ylsulfanylisoquinolin-1-amine?
The canonical SMILES for potassium;hydrogen carbonate;6-piperidin-3-ylsulfanylisoquinolin-1-amine is Nc1nccc2cc(SC3CCCNC3)ccc12.O=C([O-])O.[K+].
What is the InChIKey of potassium;hydrogen carbonate;6-piperidin-3-ylsulfanylisoquinolin-1-amine?
The InChIKey is JYKFAFZFDOGNDR-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H17N3S.CH2O3.K/c15-14-13-4-3-11(8-10(13)5-7-17-14)18-12-2-1-6-16-9-12;2-1(3)4;/h3-5,7-8,12,16H,1-2,6,9H2,(H2,15,17);(H2,2,3,4);/q;;+1/p-1.
What are the key properties of potassium;hydrogen carbonate;6-piperidin-3-ylsulfanylisoquinolin-1-amine?
potassium;hydrogen carbonate;6-piperidin-3-ylsulfanylisoquinolin-1-amine has a molecular weight of 359.49 g/mol, XLogP of -1.45, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydrogen carbonate;6-piperidin-3-ylsulfanylisoquinolin-1-amine is sourced from PubChem (CID 69442681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).