C19H28N2 — CID 69442871
N-[2-(1,9a,10,10a-tetrahydropyrido[1,2-a]indol-10-yl)ethyl]pentan-1-amine (PubChem CID 69442871) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is N-[2-(1,9a,10,10a-tetrahydropyrido[1,2-a]indol-10-yl)ethyl]pentan-1-amine.
| Compound Name | N-[2-(1,9a,10,10a-tetrahydropyrido[1,2-a]indol-10-yl)ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 69442871 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | N-[2-(1,9a,10,10a-tetrahydropyrido[1,2-a]indol-10-yl)ethyl]pentan-1-amine |
| SMILES | CCCCCNCCC1C2CC=CC=C2N2C=CC=CC12 |
| InChI | InChI=1S/C19H28N2/c1-2-3-7-13-20-14-12-17-16-9-4-5-10-18(16)21-15-8-6-11-19(17)21/h4-6,8,10-11,15-17,19-20H,2-3,7,9,12-14H2,1H3 |
| InChIKey | KWIJCARWRQIGJE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|