C20H21F3N2O2S — CID 69443258
8-azabicyclo[3.2.1]octan-3-ylmethyl N-thiophen-3-yl-N-[(2,4,5-trifluorophenyl)methyl]carbamate (PubChem CID 69443258) has the molecular formula C20H21F3N2O2S and a molecular weight of 410.46 g/mol. Its IUPAC name is 8-azabicyclo[3.2.1]octan-3-ylmethyl N-thiophen-3-yl-N-[(2,4,5-trifluorophenyl)methyl]carbamate.
| Compound Name | 8-azabicyclo[3.2.1]octan-3-ylmethyl N-thiophen-3-yl-N-[(2,4,5-trifluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 69443258 |
| Molecular Formula | C20H21F3N2O2S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 8-azabicyclo[3.2.1]octan-3-ylmethyl N-thiophen-3-yl-N-[(2,4,5-trifluorophenyl)methyl]carbamate |
| SMILES | O=C(OCC1CC2CCC(C1)N2)N(Cc1cc(F)c(F)cc1F)c1ccsc1 |
| InChI | InChI=1S/C20H21F3N2O2S/c21-17-8-19(23)18(22)7-13(17)9-25(16-3-4-28-11-16)20(26)27-10-12-5-14-1-2-15(6-12)24-14/h3-4,7-8,11-12,14-15,24H,1-2,5-6,9-10H2 |
| InChIKey | IOGLBAPYOHYWET-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|