About (6-oxo-1H-pyrimidin-2-yl)urea;urea
(6-oxo-1H-pyrimidin-2-yl)urea;urea (PubChem CID 69443941) has the molecular formula C6H10N6O3
and a molecular weight of 214.19 g/mol. Its IUPAC name is (6-oxo-1H-pyrimidin-2-yl)urea;urea.
Molecular Properties
| Compound Name | (6-oxo-1H-pyrimidin-2-yl)urea;urea |
| PubChem CID | 69443941 |
| Molecular Formula | C6H10N6O3 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (6-oxo-1H-pyrimidin-2-yl)urea;urea |
| SMILES | NC(=O)Nc1nccc(=O)[nH]1.NC(N)=O |
| InChI | InChI=1S/C5H6N4O2.CH4N2O/c6-4(11)9-5-7-2-1-3(10)8-5;2-1(3)4/h1-2H,(H4,6,7,8,9,10,11);(H4,2,3,4) |
| InChIKey | FIRIUUKTOSDKTR-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 169.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-oxo-1H-pyrimidin-2-yl)urea;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-oxo-1H-pyrimidin-2-yl)urea;urea?
The IUPAC name of (6-oxo-1H-pyrimidin-2-yl)urea;urea (CID 69443941) is (6-oxo-1H-pyrimidin-2-yl)urea;urea.
What is the SMILES notation for (6-oxo-1H-pyrimidin-2-yl)urea;urea?
The canonical SMILES for (6-oxo-1H-pyrimidin-2-yl)urea;urea is NC(=O)Nc1nccc(=O)[nH]1.NC(N)=O.
What is the InChIKey of (6-oxo-1H-pyrimidin-2-yl)urea;urea?
The InChIKey is FIRIUUKTOSDKTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4O2.CH4N2O/c6-4(11)9-5-7-2-1-3(10)8-5;2-1(3)4/h1-2H,(H4,6,7,8,9,10,11);(H4,2,3,4).
What are the key properties of (6-oxo-1H-pyrimidin-2-yl)urea;urea?
(6-oxo-1H-pyrimidin-2-yl)urea;urea has a molecular weight of 214.19 g/mol, XLogP of -1.72, 1 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-oxo-1H-pyrimidin-2-yl)urea;urea is sourced from PubChem (CID 69443941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).