About N-butyl-1,4-oxazepine-5-carboxamide
N-butyl-1,4-oxazepine-5-carboxamide (PubChem CID 69444220) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is N-butyl-1,4-oxazepine-5-carboxamide.
Molecular Properties
| Compound Name | N-butyl-1,4-oxazepine-5-carboxamide |
| PubChem CID | 69444220 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | N-butyl-1,4-oxazepine-5-carboxamide |
| SMILES | CCCCNC(=O)C1=NC=COC=C1 |
| InChI | InChI=1S/C10H14N2O2/c1-2-3-5-12-10(13)9-4-7-14-8-6-11-9/h4,6-8H,2-3,5H2,1H3,(H,12,13) |
| InChIKey | PKSFEWYHPLPNTA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-1,4-oxazepine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-1,4-oxazepine-5-carboxamide?
The IUPAC name of N-butyl-1,4-oxazepine-5-carboxamide (CID 69444220) is N-butyl-1,4-oxazepine-5-carboxamide.
What is the SMILES notation for N-butyl-1,4-oxazepine-5-carboxamide?
The canonical SMILES for N-butyl-1,4-oxazepine-5-carboxamide is CCCCNC(=O)C1=NC=COC=C1.
What is the InChIKey of N-butyl-1,4-oxazepine-5-carboxamide?
The InChIKey is PKSFEWYHPLPNTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-2-3-5-12-10(13)9-4-7-14-8-6-11-9/h4,6-8H,2-3,5H2,1H3,(H,12,13).
What are the key properties of N-butyl-1,4-oxazepine-5-carboxamide?
N-butyl-1,4-oxazepine-5-carboxamide has a molecular weight of 194.23 g/mol, XLogP of 1.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-1,4-oxazepine-5-carboxamide is sourced from PubChem (CID 69444220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).