About 7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide
7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide (PubChem CID 69444225) has the molecular formula C9H9BrO2S
and a molecular weight of 261.14 g/mol. Its IUPAC name is 7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide.
Molecular Properties
| Compound Name | 7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide |
| PubChem CID | 69444225 |
| Molecular Formula | C9H9BrO2S |
| Molecular Weight | 261.14 g/mol |
| Exact Mass | 259.95 |
| IUPAC Name | 7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide |
| SMILES | O=S1(=O)CCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C9H9BrO2S/c10-8-4-3-7-2-1-5-13(11,12)9(7)6-8/h3-4,6H,1-2,5H2 |
| InChIKey | DMJMKTQTDONYHP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.14 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide?
The IUPAC name of 7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide (CID 69444225) is 7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide.
What is the SMILES notation for 7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide?
The canonical SMILES for 7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide is O=S1(=O)CCCc2ccc(Br)cc21.
What is the InChIKey of 7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide?
The InChIKey is DMJMKTQTDONYHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO2S/c10-8-4-3-7-2-1-5-13(11,12)9(7)6-8/h3-4,6H,1-2,5H2.
What are the key properties of 7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide?
7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide has a molecular weight of 261.14 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide is sourced from PubChem (CID 69444225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).